Methyl 1-((2-Benzyloxycarbonxyl)phenyl)-2,3,4-tri-O-acetyl--D-glucopyranuronate structure
|
Common Name | Methyl 1-((2-Benzyloxycarbonxyl)phenyl)-2,3,4-tri-O-acetyl--D-glucopyranuronate | ||
|---|---|---|---|---|
| CAS Number | 221287-88-3 | Molecular Weight | 544.50400 | |
| Density | 1.347g/cm3 | Boiling Point | 612.873ºC at 760 mmHg | |
| Molecular Formula | C27H28O12 | Melting Point | 131-135ºC | |
| MSDS | N/A | Flash Point | 258.702ºC | |
| Name | Methyl 1-((2-Benzyloxycarbonxyl)phenyl)-2,3,4-tri-O-acetyl-β-D-glucopyranuronate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 612.873ºC at 760 mmHg |
| Melting Point | 131-135ºC |
| Molecular Formula | C27H28O12 |
| Molecular Weight | 544.50400 |
| Flash Point | 258.702ºC |
| Exact Mass | 544.15800 |
| PSA | 160.96000 |
| LogP | 1.55560 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | GSTDLQNCIWASGN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1OC(Oc2ccccc2C(=O)OCc2ccccc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
|
~59%
Methyl 1-((2-Be... CAS#:221287-88-3 |
| Literature: Rossignol, Jean-Francois; Stachulski, Andrew V. Journal of Chemical Research - Part S, 1999 , # 1 p. 44 - 45 |
| 2-[(Phenylmethoxy)carbonyl]phenyl-D-Glucopyranosiduronic Acid Methyl Ester Triacetate |
| 2-[(PhenylMethoxy)carbonyl]phenyl |
| Methyl 1-((2-Benzyloxycarbonxyl)phenyl)-2,3,4-tri-O-acetyl--D-glucopyranuronate |