n-(3-acetylthiopropyl)phthalimide 97
Modify Date: 2025-09-14 15:56:17
n-(3-acetylthiopropyl)phthalimide 97 structure
|
Common Name | n-(3-acetylthiopropyl)phthalimide 97 | ||
|---|---|---|---|---|
| CAS Number | 221218-66-2 | Molecular Weight | 263.31200 | |
| Density | 1.311g/cm3 | Boiling Point | 406.1ºC at 760 mmHg | |
| Molecular Formula | C13H13NO3S | Melting Point | 90-94ºC(lit.) | |
| MSDS | USA | Flash Point | 199.4ºC | |
| Name | S-[3-(1,3-dioxoisoindol-2-yl)propyl] ethanethioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.311g/cm3 |
|---|---|
| Boiling Point | 406.1ºC at 760 mmHg |
| Melting Point | 90-94ºC(lit.) |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.31200 |
| Flash Point | 199.4ºC |
| Exact Mass | 263.06200 |
| PSA | 79.75000 |
| LogP | 1.89030 |
| Vapour Pressure | 8.36E-07mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | QDCSBRSBDZXURK-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCCN1C(=O)c2ccccc2C1=O |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| MFCD00189168 |