3-ethoxy-4-phenylcyclobut-3-ene-1,2-dione
Modify Date: 2025-09-12 08:15:38
3-ethoxy-4-phenylcyclobut-3-ene-1,2-dione structure
|
Common Name | 3-ethoxy-4-phenylcyclobut-3-ene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 22118-95-2 | Molecular Weight | 202.20600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethoxy-4-phenylcyclobut-3-ene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10O3 |
|---|---|
| Molecular Weight | 202.20600 |
| Exact Mass | 202.06300 |
| PSA | 43.37000 |
| LogP | 1.58600 |
| InChIKey | LMTYIKOPVCNHLD-UHFFFAOYSA-N |
| SMILES | CCOc1c(-c2ccccc2)c(=O)c1=O |
| HS Code | 2914509090 |
|---|
|
~%
3-ethoxy-4-phen... CAS#:22118-95-2 |
| Literature: Yamamoto, Yoshihiko; Kuwabara, Shoji; Hayashi, Hiroki; Nishiyama, Hisao Advanced Synthesis and Catalysis, 2006 , vol. 348, # 16-17 p. 2493 - 2500 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:708-10-1| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-ethoxy-4-phenyl-3-cyclobutene-1,2-dione |
| 3-ethoxy-4-phenyl-3-cyclobutylene-1,2-dione |
| 3-Cyclobutene-1,2-dione,3-ethoxy-4-phenyl |
| 3-ethoxy-4-phenylcyclobutadienone |
| 4-ethoxy-3-phenyl-3-cyclobutene-1,2-dione |
| 1-Phenyl-2-ethoxy-cyclobuten-3,4-dion |
| 4-Ethoxy-3-phenylcyclobuten-1,2-dion |