5-aminosaccharin
Modify Date: 2025-10-16 17:44:03
5-aminosaccharin structure
|
Common Name | 5-aminosaccharin | ||
|---|---|---|---|---|
| CAS Number | 22094-61-7 | Molecular Weight | 198.19900 | |
| Density | 1.652g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H6N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-amino-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.652g/cm3 |
|---|---|
| Molecular Formula | C7H6N2O3S |
| Molecular Weight | 198.19900 |
| Exact Mass | 198.01000 |
| PSA | 101.13000 |
| LogP | 1.37330 |
| Index of Refraction | 1.684 |
| InChIKey | XHLASMNHDRLNJQ-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)C(=O)NS2(=O)=O |
| HS Code | 2934100090 |
|---|
|
~%
5-aminosaccharin CAS#:22094-61-7 |
| Literature: GLAXO GROUP LIMITED Patent: WO2006/129100 A1, 2006 ; Location in patent: Page/Page column 36 ; WO 2006/129100 A1 |
|
~%
5-aminosaccharin CAS#:22094-61-7 |
| Literature: Warren,A.; Hamor,G.H. Journal of Pharmaceutical Sciences, 1961 , vol. 50, p. 625 - 626 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-amino-2,3-dihydro-1 |
| 5-AMINO-2,3-DIHYDRO-1 |
| L^{6},2-BENZOTHIAZOLE-1,1,3-TRIONE |
| 1,2-Benzisothiazol-3(2H)-one,5-amino-,1,1-dioxide |
| 5-Amino-saccharin |
| 5-amino-1,2-benzisothiazol-3(2H)-one 1,1-dioxide |