N-(2-nitrocyclooctylidene)hydroxylamine
Modify Date: 2025-10-13 17:10:29
N-(2-nitrocyclooctylidene)hydroxylamine structure
|
Common Name | N-(2-nitrocyclooctylidene)hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 2209-35-0 | Molecular Weight | 186.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-nitrocyclooctylidene)hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H14N2O3 |
|---|---|
| Molecular Weight | 186.20800 |
| Exact Mass | 186.10000 |
| PSA | 78.41000 |
| LogP | 2.33930 |
| InChIKey | VIIQLANGSSDPDI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C1CCCCCCC1=NO |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-nitro-cyclooctanone oxime |
| Cyclooctanone,2-nitro-,oxime |