MMPSI
Modify Date: 2025-08-25 10:29:15
MMPSI structure
|
Common Name | MMPSI | ||
|---|---|---|---|---|
| CAS Number | 220509-74-0 | Molecular Weight | 324.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MMPSIMMPSI is a potent and selective small molecule caspase 3 and caspase 7 inhibitor with an IC50 of 1.7 μM for human caspase-3. MMPSI can significantly reduce ischemia-reperfusion-induced infarct size in the isolated rabbit heart, and reduce apoptosis in both the ischemic myocardium and isolated cardiomyocytes. MMPSI can be used for researching cardioprotection[1]. |
| Name | (S)-5-[1-(2-methoxymethylpyrrolidinyl)sulfonyl]isatin |
|---|---|
| Synonym | More Synonyms |
| Description | MMPSI is a potent and selective small molecule caspase 3 and caspase 7 inhibitor with an IC50 of 1.7 μM for human caspase-3. MMPSI can significantly reduce ischemia-reperfusion-induced infarct size in the isolated rabbit heart, and reduce apoptosis in both the ischemic myocardium and isolated cardiomyocytes. MMPSI can be used for researching cardioprotection[1]. |
|---|---|
| Related Catalog | |
| Target |
human Caspase-3:1.7 μM (IC50) |
| References |
| Molecular Formula | C14H16N2O5S |
|---|---|
| Molecular Weight | 324.35 |
| Exact Mass | 324.07800 |
| PSA | 101.16000 |
| LogP | 1.77760 |
| InChIKey | SLQMNVJNDYLJSF-VIFPVBQESA-N |
| SMILES | COCC1CCCN1S(=O)(=O)c1ccc2c(c1)C(=O)C(=O)N2 |
| (S)-5-[1-(2-(methoxymethyl)pyrrolidinyl)sulfonyl]isatin |
| (S)-5-(2-(methoxymethyl)pyrrolidin-1-ylsulfonyl)indoline-2,3-dione |
| 5-((S)-2-Methoxymethyl-pyrrolidine-1-sulfonyl)-1H-indole-2,3-dione |
| (S)-5-((2-(methoxymethyl)pyrrolidin-1-yl)sulfonyl)indoline-2,3-dione |
| 5-(S)-(2-methoxymethyl)pyrrolidinylsulfonyl isatin |
| (S)-(+)-5-[2-methoxymethylpyrrolidin-1-ylsulfonyl]isatin |
| (S)-5-[(2-methoxymethylpyrrolidin-1-yl)sulfonyl]isatin |