Clonostachydiol
Modify Date: 2025-08-26 15:34:30
Clonostachydiol structure
|
Common Name | Clonostachydiol | ||
|---|---|---|---|---|
| CAS Number | 2205018-06-8 | Molecular Weight | 284.305 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 572.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C14H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.0±23.6 °C | |
Use of ClonostachydiolClonostachydiol is an anthelmintic macrodiolide from the fungus Clonostachys cylindrospora (strain FH-A 6607)[1]. |
| Name | Clonostachydiol |
|---|---|
| Synonym | More Synonyms |
| Description | Clonostachydiol is an anthelmintic macrodiolide from the fungus Clonostachys cylindrospora (strain FH-A 6607)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 572.7±50.0 °C at 760 mmHg |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.305 |
| Flash Point | 216.0±23.6 °C |
| Exact Mass | 284.125977 |
| LogP | -0.47 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | SSVNIYICRYPPEB-GSVQBQKSSA-N |
| SMILES | CC1CCC(O)C=CC(=O)OC(C)C(O)C=CC(=O)O1 |
| 1,7-Dioxacyclotetradeca-3,9-diene-2,8-dione, 5,11-dihydroxy-6,14-dimethyl-, (3E,5R,6S,9E,11S,14S)- |
| (3E,5R,6S,9E,11S,14S)-5,11-Dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione |
| clonostachydiol |