2-Phenoxy-1,4-naphthoquinone structure
|
Common Name | 2-Phenoxy-1,4-naphthoquinone | ||
|---|---|---|---|---|
| CAS Number | 220459-72-3 | Molecular Weight | 250.249 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 395.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C16H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.5±27.9 °C | |
| Name | 2-phenoxynaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.1±42.0 °C at 760 mmHg |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.249 |
| Flash Point | 176.5±27.9 °C |
| Exact Mass | 250.062988 |
| PSA | 43.37000 |
| LogP | 4.32 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | UCWKLNZSXHXPMB-UHFFFAOYSA-N |
| SMILES | O=C1C=C(Oc2ccccc2)C(=O)c2ccccc21 |
|
~70%
2-Phenoxy-1,4-n... CAS#:220459-72-3 |
| Literature: Bolognesi, Maria Laura; Lizzi, Federica; Perozzo, Remo; Brun, Reto; Cavalli, Andrea Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 7 p. 2272 - 2276 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,4-Naphthalenedione, 2-phenoxy- |
| 2-Phenoxy-1,4-naphthoquinone |