Phosphonium,[(1E)-2-carboxyethenyl]triphenyl-, bromide (9CI) structure
|
Common Name | Phosphonium,[(1E)-2-carboxyethenyl]triphenyl-, bromide (9CI) | ||
|---|---|---|---|---|
| CAS Number | 22038-50-2 | Molecular Weight | 413.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18BrO2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(E)-2-carboxyethenyl]-triphenylphosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H18BrO2P |
|---|---|
| Molecular Weight | 413.24400 |
| Exact Mass | 412.02300 |
| PSA | 50.89000 |
| LogP | 0.58280 |
| InChIKey | VVXMGRMXHBKXGK-CMBBICFISA-N |
| SMILES | O=C(O)C=C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
|
~%
Phosphonium,[(1... CAS#:22038-50-2 |
| Literature: Pattenden,G.; Walker,B.J. Journal of the Chemical Society [Section] C: Organic, 1969 , p. 531 - 535 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| trans-2-Carboxy-vinyl-triphenylphosphoniumbromid |