Eichlerialactone structure
|
Common Name | Eichlerialactone | ||
|---|---|---|---|---|
| CAS Number | 2202-01-9 | Molecular Weight | 430.62 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 557.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C27H42O4 | Melting Point | 146-148 °C | |
| MSDS | N/A | Flash Point | 178.5±23.6 °C | |
Use of EichlerialactoneEichlerialactone is a sesquiterpene compound isolated from Chisocheton penduliflorus. Eichlerialactone is weakly cytotoxic to breast cancer cells[1]. |
| Name | Eichlerialactone |
|---|---|
| Synonym | More Synonyms |
| Description | Eichlerialactone is a sesquiterpene compound isolated from Chisocheton penduliflorus. Eichlerialactone is weakly cytotoxic to breast cancer cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 557.0±50.0 °C at 760 mmHg |
| Melting Point | 146-148 °C |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.62 |
| Flash Point | 178.5±23.6 °C |
| Exact Mass | 430.308319 |
| PSA | 63.60000 |
| LogP | 6.91 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | LEKUPXHLKIIVCR-FAKJQIDCSA-N |
| SMILES | C=C(C)C1CCC2(C)C(CCC3C(C4(C)CCC(=O)O4)CCC32C)C1(C)CCC(=O)O |
| 1H-Benz[e]indene-6-propanoic acid, dodecahydro-6,9a,9b-trimethyl-7-(1-methylethenyl)-3-[(2S)-tetrahydro-2-methyl-5-oxo-2-furanyl]-, (3S,3aR,5aR,6S,7S,9aR,9bR)- |
| 3-{(3S,3aR,5aR,6S,7S,9aR,9bR)-7-Isopropenyl-6,9a,9b-trimethyl-3-[(2S)-2-methyl-5-oxotetrahydro-2-furanyl]dodecahydro-1H-cyclopenta[a]naphthalen-6-yl}propanoic acid |