MAT2A inhibitor structure
|
Common Name | MAT2A inhibitor | ||
|---|---|---|---|---|
| CAS Number | 2201057-10-3 | Molecular Weight | 526.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H22N6OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MAT2A inhibitorMAT2A inhibitor is a methionine adenosyltransferase 2A (MATA2 ) inhibitor extracted from patent US20180079753, compound example 196 (4). |
| Name | MAT2A inhibitor |
|---|
| Description | MAT2A inhibitor is a methionine adenosyltransferase 2A (MATA2 ) inhibitor extracted from patent US20180079753, compound example 196 (4). |
|---|---|
| Related Catalog | |
| Target |
MATA2[1] |
| References |
[1]. Konteatis Z, et al. Inhibitors of cellular metabolic processes. US20180079753. |
| Molecular Formula | C31H22N6OS |
|---|---|
| Molecular Weight | 526.61 |
| InChIKey | ZTNQNZDNHUAVEI-UHFFFAOYSA-N |
| SMILES | Cc1nc2ccc(-c3c(Nc4ccccn4)[nH]c4c(-c5ccccc5)c(-c5ccccc5)nn4c3=O)cc2s1 |