1,3-dinitro-2-(4-nitrophenyl)benzene structure
|
Common Name | 1,3-dinitro-2-(4-nitrophenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 22001-00-9 | Molecular Weight | 289.20000 | |
| Density | 1.52g/cm3 | Boiling Point | 441.4ºC at 760mmHg | |
| Molecular Formula | C12H7N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.1ºC | |
| Name | 1,3-dinitro-2-(4-nitrophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 441.4ºC at 760mmHg |
| Molecular Formula | C12H7N3O6 |
| Molecular Weight | 289.20000 |
| Flash Point | 217.1ºC |
| Exact Mass | 289.03300 |
| PSA | 137.46000 |
| LogP | 4.64780 |
| Vapour Pressure | 1.42E-07mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | ZIAXQDGZKOVDIO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-c2c([N+](=O)[O-])cccc2[N+](=O)[O-])cc1 |
| HS Code | 2904209090 |
|---|
|
~85%
1,3-dinitro-2-(... CAS#:22001-00-9 |
| Literature: Cornforth, John; Sierakowski, Andrew F.; Wallace Timothy W. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 10 p. 2299 - 2316 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,6,4'-Trinitrobiphenyl |
| 1,1'-Biphenyl,2,4',6-trinitro |
| 2,4',6-trinitrobiphenyl |