4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine
Modify Date: 2025-09-09 12:16:20
4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine structure
|
Common Name | 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine | ||
|---|---|---|---|---|
| CAS Number | 219701-26-5 | Molecular Weight | 265.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19NO4 |
|---|---|
| Molecular Weight | 265.30 |
| InChIKey | YRPNKZTUKSAGGP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C)nc(C)c(C(=O)OC)c1C(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine? |
| A: CAS number of 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine is 219701-26-5. |
| Q: What is the SMILES notation of 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine? |
| A: SMILES notation of 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine is COC(=O)c1c(C)nc(C)c(C(=O)OC)c1C(C)C. |
| Q: What is the English name of 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine? |
| A: The English name of 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine is 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine. |
| Q: What is the InChIKey of 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine? |
| A: InChIKey of 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine is YRPNKZTUKSAGGP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 219701-26-5? |
| A: Chinese name of 219701-26-5 is 219701-26-5. |
| Q: What is the molecular formula of 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine? |
| A: Molecular formula of 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine is C14H19NO4. |
| Q: What is the molecular weight of 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine? |
| A: Molecular weight of 4-Isopropyl-3,5-dimethoxycarbonyl-2,6-dimethylpyridine is 265.30. |