3-(2-methylpiperidin-1-ium-1-yl)propyl 4-chlorobenzoate,chloride structure
|
Common Name | 3-(2-methylpiperidin-1-ium-1-yl)propyl 4-chlorobenzoate,chloride | ||
|---|---|---|---|---|
| CAS Number | 21969-62-0 | Molecular Weight | 332.26500 | |
| Density | N/A | Boiling Point | 396.5ºC at 760mmHg | |
| Molecular Formula | C16H23Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | 3-(2-methylpiperidin-1-ium-1-yl)propyl 4-chlorobenzoate,chloride |
|---|
| Boiling Point | 396.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H23Cl2NO2 |
| Molecular Weight | 332.26500 |
| Flash Point | 193.6ºC |
| Exact Mass | 331.11100 |
| PSA | 29.54000 |
| LogP | 4.50120 |
| Vapour Pressure | 1.7E-06mmHg at 25°C |
| InChIKey | KKMAECIINSWJFQ-UHFFFAOYSA-N |
| SMILES | CC1CCCC[NH+]1CCCOC(=O)c1ccc(Cl)cc1.[Cl-] |
|
~%
3-(2-methylpipe... CAS#:21969-62-0 |
| Literature: McElvain; Carney Journal of the American Chemical Society, 1946 , vol. 68, p. 2592,2599 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |