Deoxygedunin
Modify Date: 2025-10-01 09:10:41
Deoxygedunin structure
|
Common Name | Deoxygedunin | ||
|---|---|---|---|---|
| CAS Number | 21963-95-1 | Molecular Weight | 466.56600 | |
| Density | 1.22g/cm3 | Boiling Point | 586.1ºC at 760 mmHg | |
| Molecular Formula | C28H34O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.3ºC | |
Use of DeoxygeduninA naturally occurring tetranortriterpenoid that has been found to act as a potent, selective, small-molecule agonist of TrkB with Kd of 1.4 uM. |
| Name | [(1R,4bR,5R,6aR,10aR,10bR,12aR)-1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-5,6,6a,10b,11,12-hexahydro-1H-naphtho[2,1-f]isochromen-5-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 586.1ºC at 760 mmHg |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.56600 |
| Flash Point | 308.3ºC |
| Exact Mass | 466.23600 |
| PSA | 82.81000 |
| LogP | 5.34950 |
| Vapour Pressure | 1.01E-13mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | VOUDTVRGPAGHGA-SQIPALKSSA-N |
| SMILES | CC(=O)OC1CC2C(C)(C)C(=O)C=CC2(C)C2CCC3(C)C(=CC(=O)OC3c3ccoc3)C12C |
| Deoxygedunin |
| (1R,4bR,5R,6aR,10aR,10bR,12aR)-1-(Furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-3,4b,5,6,6a,7,8,10a,10b,11,12,12a-dodecahydro-1H-naphtho[2,1-f]isochromen-5-yl acetate |
| GEDUNIN,15-DEOXY |
| 14,15-deoxygedunin |
| [3H]-Deoxygedunin |