1-naphthalen-1-yloxy-3-(propan-2-ylamino)butan-2-ol
Modify Date: 2025-08-27 20:55:35
1-naphthalen-1-yloxy-3-(propan-2-ylamino)butan-2-ol structure
|
Common Name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)butan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 21912-00-5 | Molecular Weight | 273.37000 | |
| Density | 1.076g/cm3 | Boiling Point | 440.3ºC at 760mmHg | |
| Molecular Formula | C17H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1ºC | |
| Name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)butan-2-ol |
|---|
| Density | 1.076g/cm3 |
|---|---|
| Boiling Point | 440.3ºC at 760mmHg |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.37000 |
| Flash Point | 220.1ºC |
| Exact Mass | 273.17300 |
| PSA | 41.49000 |
| LogP | 3.35690 |
| Vapour Pressure | 1.57E-08mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | CILPUBLECPRREJ-UHFFFAOYSA-N |
| SMILES | CC(C)NC(C)C(O)COc1cccc2ccccc12 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |