2-(9H-fluoren-2-yl-(2-hydroxyethyl)amino)ethanol structure
|
Common Name | 2-(9H-fluoren-2-yl-(2-hydroxyethyl)amino)ethanol | ||
|---|---|---|---|---|
| CAS Number | 21865-57-6 | Molecular Weight | 269.33800 | |
| Density | 1.256g/cm3 | Boiling Point | 514.6ºC at 760 mmHg | |
| Molecular Formula | C17H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.6ºC | |
| Name | 2-[9H-fluoren-2-yl(2-hydroxyethyl)amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 514.6ºC at 760 mmHg |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.33800 |
| Flash Point | 299.6ºC |
| Exact Mass | 269.14200 |
| PSA | 43.70000 |
| LogP | 2.04880 |
| Vapour Pressure | 2.05E-11mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | IGXYLBZHGRVGHD-UHFFFAOYSA-N |
| SMILES | OCCN(CCO)c1ccc2c(c1)Cc1ccccc1-2 |
|
~%
2-(9H-fluoren-2... CAS#:21865-57-6 |
| Literature: Everett; Ross Journal of the Chemical Society, 1949 , p. 1972,1974 |
| 2-<N.N-Di-(2-hydroxy-aethyl)-amino>-fluoren |
| fluoren-2-yl-bis-(2-hydroxy-ethyl)-amine |
| Fluoren-2-yl-bis-(2-hydroxy-aethyl)-amin |
| 2,2'-(Fluoren-2-ylimino)diethanol |
| 2,2'-(9h-fluoren-2-ylimino)diethanol |