1,3,5-Triazine-2,4,6-triamine,N2,N4,N6-tris(1,1,3,3-tetramethylbutyl)- structure
|
Common Name | 1,3,5-Triazine-2,4,6-triamine,N2,N4,N6-tris(1,1,3,3-tetramethylbutyl)- | ||
|---|---|---|---|---|
| CAS Number | 21840-38-0 | Molecular Weight | 462.75800 | |
| Density | 0.975g/cm3 | Boiling Point | 546.7ºC at 760mmHg | |
| Molecular Formula | C27H54N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.4ºC | |
| Name | 2-N,4-N,6-N-tris(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine |
|---|
| Density | 0.975g/cm3 |
|---|---|
| Boiling Point | 546.7ºC at 760mmHg |
| Molecular Formula | C27H54N6 |
| Molecular Weight | 462.75800 |
| Flash Point | 284.4ºC |
| Exact Mass | 462.44100 |
| PSA | 74.76000 |
| LogP | 7.97070 |
| Vapour Pressure | 5.26E-12mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | DBUFHHJVYLAZLZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)Nc1nc(NC(C)(C)CC(C)(C)C)nc(NC(C)(C)CC(C)(C)C)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |