ethyl 5-fluoro-2,4-dioxopyrimidine-1-carboxylate
Modify Date: 2025-09-25 15:41:21
ethyl 5-fluoro-2,4-dioxopyrimidine-1-carboxylate structure
|
Common Name | ethyl 5-fluoro-2,4-dioxopyrimidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 21839-33-8 | Molecular Weight | 202.14000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 5-fluoro-2,4-dioxopyrimidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7FN2O4 |
|---|---|
| Molecular Weight | 202.14000 |
| Exact Mass | 202.03900 |
| PSA | 81.42000 |
| LogP | 0.09260 |
| InChIKey | XRHUFADXPHBXFZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)n1cc(F)c(=O)[nH]c1=O |
| HS Code | 2933599090 |
|---|
|
~31%
ethyl 5-fluoro-... CAS#:21839-33-8 |
| Literature: Yamashita; Yamawaki; Ueda; Yasumoto; Unemi; Hashimoto Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 12 p. 4258 - 4267 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:64-17-5| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-ethyloxycarbonyl-5-fluorouracil |