2-phenyl-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione structure
|
Common Name | 2-phenyl-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 2179-08-0 | Molecular Weight | 230.26200 | |
| Density | 1.31g/cm3 | Boiling Point | 347.1ºC at 760mmHg | |
| Molecular Formula | C13H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.7ºC | |
| Name | 2-phenyl-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 347.1ºC at 760mmHg |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.26200 |
| Flash Point | 150.7ºC |
| Exact Mass | 230.10600 |
| PSA | 40.62000 |
| LogP | 2.01060 |
| Vapour Pressure | 5.49E-05mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | QWAOLYQIJVREPT-UHFFFAOYSA-N |
| SMILES | O=C1C2CCCCN2C(=O)N1c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Dioxo-2-azaphenyl-indolizidin |
| N-Phenyl-1,2-piperidinedicarboximide |
| 1,2-Piperidinedicarboximide,N-phenyl |
| 2-phenyl-2,5,6,7,8,8a-hexahydro-2-azaindolizine-1,3-dione |
| 1.5-Tetramethylen-3-phenyl-hydantoin |
| 3-Phenyl-piperidino<1',2':1,5>-hydantoin |