8-methyl-9,9-dioxo-9$l^{6}-thia-8-azabicyclo[4.4.0]deca-1,3,5-trien-7- one structure
|
Common Name | 8-methyl-9,9-dioxo-9$l^{6}-thia-8-azabicyclo[4.4.0]deca-1,3,5-trien-7- one | ||
|---|---|---|---|---|
| CAS Number | 21784-54-3 | Molecular Weight | 211.23800 | |
| Density | 1.404g/cm3 | Boiling Point | 382.7ºC at 760 mmHg | |
| Molecular Formula | C9H9NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.3ºC | |
| Name | 3-methyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.404g/cm3 |
|---|---|
| Boiling Point | 382.7ºC at 760 mmHg |
| Molecular Formula | C9H9NO3S |
| Molecular Weight | 211.23800 |
| Flash Point | 185.3ºC |
| Exact Mass | 211.03000 |
| PSA | 62.83000 |
| LogP | 1.62070 |
| Vapour Pressure | 4.62E-06mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | RAQMXXMLEHZQQE-UHFFFAOYSA-N |
| SMILES | CN1C(=O)c2ccccc2CS1(=O)=O |
| HS Code | 2914399090 |
|---|
|
~%
8-methyl-9,9-di... CAS#:21784-54-3 |
| Literature: Sianesi; Redaelli; Magistretti; Massarani Journal of Medicinal Chemistry, 1973 , vol. 16, # 10 p. 1133 - 1137 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 3-Methyl-3,4-dihydro-4-oxo-1H-2,3-benzothiazin-S-dioxid |