1-(5-chloropyridin-2-yl)-3-phenylthiourea
Modify Date: 2025-08-22 21:42:07
1-(5-chloropyridin-2-yl)-3-phenylthiourea structure
|
Common Name | 1-(5-chloropyridin-2-yl)-3-phenylthiourea | ||
|---|---|---|---|---|
| CAS Number | 21780-62-1 | Molecular Weight | 263.74600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(5-chloropyridin-2-yl)-3-phenylthiourea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10ClN3S |
|---|---|
| Molecular Weight | 263.74600 |
| Exact Mass | 263.02800 |
| PSA | 76.08000 |
| LogP | 3.83740 |
| InChIKey | COMALOUJGNUXFH-UHFFFAOYSA-N |
| SMILES | S=C(Nc1ccccc1)Nc1ccc(Cl)cn1 |
|
~%
1-(5-chloropyri... CAS#:21780-62-1 |
| Literature: Buu-Hoi et al. Journal of the Chemical Society, 1958 , p. 2815,2818 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hms2713m18 |