Urea,N-(5-chloro-2-pyridinyl)-N'-ethyl-
Modify Date: 2025-11-25 10:24:00
Urea,N-(5-chloro-2-pyridinyl)-N'-ethyl- structure
|
Common Name | Urea,N-(5-chloro-2-pyridinyl)-N'-ethyl- | ||
|---|---|---|---|---|
| CAS Number | 21780-53-0 | Molecular Weight | 199.63700 | |
| Density | 1.304g/cm3 | Boiling Point | 293.8ºC at 760 mmHg | |
| Molecular Formula | C8H10ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.5ºC | |
| Name | 1-(5-chloropyridin-2-yl)-3-ethylurea |
|---|
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 293.8ºC at 760 mmHg |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.63700 |
| Flash Point | 131.5ºC |
| Exact Mass | 199.05100 |
| PSA | 54.02000 |
| LogP | 2.34030 |
| Vapour Pressure | 0.00168mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | FGYNFQWJCAJZGA-UHFFFAOYSA-N |
| SMILES | CCNC(=O)Nc1ccc(Cl)cn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |