RUNX-IN-1
Modify Date: 2025-08-24 20:22:55
RUNX-IN-1 structure
|
Common Name | RUNX-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 2177285-35-5 | Molecular Weight | 1524.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C71H88Cl2N24O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RUNX-IN-1RUNX-IN-1 (Compound Conjugate 1) covalently binds to the RUNX-binding sequences, and inhibits the binding of RUNX proteins to their target sites. RUNX-IN-1 induces the p53-dependent apoptosis and inhibits cancer cell growth. RUNX-IN-1 inhibits tumor growth in PANC-1 xenograft mice[1]. |
| Name | RUNX-IN-1 |
|---|
| Description | RUNX-IN-1 (Compound Conjugate 1) covalently binds to the RUNX-binding sequences, and inhibits the binding of RUNX proteins to their target sites. RUNX-IN-1 induces the p53-dependent apoptosis and inhibits cancer cell growth. RUNX-IN-1 inhibits tumor growth in PANC-1 xenograft mice[1]. |
|---|---|
| Related Catalog | |
| Target |
RUNX[1] |
| References |
| Molecular Formula | C71H88Cl2N24O11 |
|---|---|
| Molecular Weight | 1524.52 |
| InChIKey | KEMUNUGWVPYFER-UHFFFAOYSA-N |
| SMILES | CN(C)CCCNC(=O)c1cc(NC(=O)c2cc(NC(=O)c3cc(NC(=O)c4cc(NC(=O)CCCNC(=O)c5nc(NC(=O)c6nc(NC(=O)c7cc(NC(=O)c8nc(NC(=O)CCNC(=O)CCCc9ccc(N(CCCl)CCCl)cc9)cn8C)cn7C)cn6C)cn5C)cn4C)cn3C)cn2C)cn1C |