2-[[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile
Modify Date: 2025-08-26 13:42:22
![2-[[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile Structure](https://image.chemsrc.com/caspic/007/21725-68-8.png)
2-[[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile structure
|
Common Name | 2-[[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile | ||
|---|---|---|---|---|
| CAS Number | 21725-68-8 | Molecular Weight | 236.27400 | |
| Density | 1.233g/cm3 | Boiling Point | 423.3ºC at 760mmHg | |
| Molecular Formula | C10H16N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.8ºC | |
| Name | 2-[[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 423.3ºC at 760mmHg |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.27400 |
| Flash Point | 209.8ºC |
| Exact Mass | 236.13900 |
| PSA | 98.98000 |
| LogP | 0.52098 |
| Vapour Pressure | 2.25E-07mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | SHANRXMTBMPTMY-UHFFFAOYSA-N |
| SMILES | CCNc1nc(NC(C)(C)C#N)nc(OC)n1 |
| HS Code | 2933699090 |
|---|
|
~%
2-[[4-(ethylami... CAS#:21725-68-8 |
| Literature: Ujvary, Istvan Pest Management Science, 2000 , vol. 56, # 8 p. 703 - 705 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| einecs 244-545-4 |