1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide
Modify Date: 2025-09-12 11:40:24
![1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide Structure](https://www.chemsrc.com/extcaspic/086/2171663-67-3.png)
1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide structure
|
Common Name | 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 2171663-67-3 | Molecular Weight | 210.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H10N4O3 |
|---|---|
| Molecular Weight | 210.19 |
| InChIKey | ITEVMIDGOXWDRH-UHFFFAOYSA-N |
| SMILES | N#CCNC(=O)C(=O)N1CCC1C(N)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide? |
| A: Molecular formula of 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide is C8H10N4O3. |
| Q: What is the SMILES notation of 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide? |
| A: SMILES notation of 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide is N#CCNC(=O)C(=O)N1CCC1C(N)=O. |
| Q: What is the CAS number of 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide? |
| A: CAS number of 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide is 2171663-67-3. |
| Q: What is the molecular weight of 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide? |
| A: Molecular weight of 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide is 210.19. |
| Q: What is the InChIKey of 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide? |
| A: InChIKey of 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide is ITEVMIDGOXWDRH-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2171663-67-3? |
| A: Chinese name of 2171663-67-3 is 2171663-67-3. |
| Q: What is the English name of 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide? |
| A: The English name of 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide is 1-{[(Cyanomethyl)carbamoyl]carbonyl}azetidine-2-carboxamide. |