6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid
Modify Date: 2026-06-30 16:24:54
![6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid Structure](https://www.chemsrc.com/extcaspic/493/2171663-52-6.png)
6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid structure
|
Common Name | 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2171663-52-6 | Molecular Weight | 468.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H32N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H32N2O6 |
|---|---|
| Molecular Weight | 468.5 |
| InChIKey | RROKTFPQVPTDGH-UHFFFAOYSA-N |
| SMILES | COC(C)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCCCCCC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid? |
| A: Molecular weight of 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid is 468.5. |
| Q: What is the molecular formula of 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid? |
| A: Molecular formula of 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid is C26H32N2O6. |
| Q: What is the Chinese name of 2171663-52-6? |
| A: Chinese name of 2171663-52-6 is 2171663-52-6. |
| Q: What is the SMILES notation of 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid? |
| A: SMILES notation of 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid is COC(C)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCCCCCC(=O)O. |
| Q: What is the English name of 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid? |
| A: The English name of 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid is 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid. |
| Q: What is the CAS number of 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid? |
| A: CAS number of 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid is 2171663-52-6. |
| Q: What is the InChIKey of 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid? |
| A: InChIKey of 6-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanamido]hexanoic acid is RROKTFPQVPTDGH-UHFFFAOYSA-N. |