WB 4101
Modify Date: 2025-11-25 17:54:01
WB 4101 structure
|
Common Name | WB 4101 | ||
|---|---|---|---|---|
| CAS Number | 2170-58-3 | Molecular Weight | 381.85 | |
| Density | 1.16g/cm3 | Boiling Point | 472.7ºC at 760mmHg | |
| Molecular Formula | C19H24ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200ºC | |
Use of WB 4101(±)-WB 4101 is a potent antagonist of noradrenaline. (±)-WB 4101 interacts with protein in smooth muscle. (±)-WB 4101 makes drug and receptor bind tightly[1]. |
| Name | N-(2,3-Dihydro-1,4-benzodioxin-2-ylmethyl)-2-(2,6-dimethoxyphenox y)ethanamine hydrochloride (1:1) |
|---|---|
| Synonym | More Synonyms |
| Description | (±)-WB 4101 is a potent antagonist of noradrenaline. (±)-WB 4101 interacts with protein in smooth muscle. (±)-WB 4101 makes drug and receptor bind tightly[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 472.7ºC at 760mmHg |
| Molecular Formula | C19H24ClNO5 |
| Molecular Weight | 381.85 |
| Flash Point | 200ºC |
| Exact Mass | 381.13400 |
| PSA | 58.18000 |
| LogP | 3.70510 |
| Vapour Pressure | 4.19E-09mmHg at 25°C |
| InChIKey | KAHMEWANVDFFCQ-UHFFFAOYSA-N |
| SMILES | COc1cccc(OC)c1OCCNCC1COc2ccccc2O1.Cl |
| Storage condition | 2-8°C |
| 2-(2,6-dimethoxyphenoxy)-1-bromoethane |
| 2-(2,6-dimethoxyphenoxyethyl)aminomethyl-1,4-benzodioxane hydrochloride |
| WB-4101 HCl |
| [3H]-WB 4101 |
| N-[2-(2,6-dimethoxyphenoxy)ethyl]-2,3-dihydro-1,4-benzodioxin-2-methanamine |
| 2-(2,6-dimethoxyphenoxyethyl)aminomethyl-1,4-benodioxane |
| 1-(2-Brom-ethoxy)-2,6-dimethoxy-benzol |
| 2-(2-Brom-aethoxy)-1,3-dimethoxy-benzol |
| 1-bromo-2-<(2,6-dimethoxy)phenoxy>ethane |
| 2-(2,6-Dimethoxyphenoxy)ethylbromide |
| 2-(2-bromo-ethoxy)-1,3-dimethoxy-benzene |
| [3H]-WB 4101 hydrochloride |
| WB-4101 hydrochloride |