Phenol,4-(1-methylethyl)-, carbonate (2:1) (9CI)
Modify Date: 2025-09-13 19:22:04
Phenol,4-(1-methylethyl)-, carbonate (2:1) (9CI) structure
|
Common Name | Phenol,4-(1-methylethyl)-, carbonate (2:1) (9CI) | ||
|---|---|---|---|---|
| CAS Number | 2167-55-7 | Molecular Weight | 298.37600 | |
| Density | 1.069g/cm3 | Boiling Point | 380.2ºC at 760mmHg | |
| Molecular Formula | C19H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.5ºC | |
| Name | bis(4-propan-2-ylphenyl) carbonate |
|---|
| Density | 1.069g/cm3 |
|---|---|
| Boiling Point | 380.2ºC at 760mmHg |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.37600 |
| Flash Point | 120.5ºC |
| Exact Mass | 298.15700 |
| PSA | 35.53000 |
| LogP | 5.51120 |
| Vapour Pressure | 5.54E-06mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | FAMYXRBOUQOMGA-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(OC(=O)Oc2ccc(C(C)C)cc2)cc1 |
| HS Code | 2920909090 |
|---|
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |