Desketoraloxifene structure
|
Common Name | Desketoraloxifene | ||
|---|---|---|---|---|
| CAS Number | 216570-81-9 | Molecular Weight | 445.57 | |
| Density | 1.256±0.06 g/cm3 | Boiling Point | 641.1±55.0 °C | |
| Molecular Formula | C27H27NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DesketoraloxifeneDesketoraloxifene is an estrogen receptors alpha (ERα) activator at an AP-1 site. Desketoraloxifene can be used for the research of osteoporosis and breast cancer[1]. |
| Name | Desketoraloxifene |
|---|
| Description | Desketoraloxifene is an estrogen receptors alpha (ERα) activator at an AP-1 site. Desketoraloxifene can be used for the research of osteoporosis and breast cancer[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.256±0.06 g/cm3 |
|---|---|
| Boiling Point | 641.1±55.0 °C |
| Molecular Formula | C27H27NO3S |
| Molecular Weight | 445.57 |
| InChIKey | ULDLKHSSWQBEPC-UHFFFAOYSA-N |
| SMILES | Oc1ccc(-c2sc3cc(O)ccc3c2-c2ccc(OCCN3CCCCC3)cc2)cc1 |