Ethanol,2-[(4-amino-5-methoxy-2-methylphenyl)sulfonyl]-, 1-(hydrogen sulfate) structure
|
Common Name | Ethanol,2-[(4-amino-5-methoxy-2-methylphenyl)sulfonyl]-, 1-(hydrogen sulfate) | ||
|---|---|---|---|---|
| CAS Number | 21635-69-8 | Molecular Weight | 325.35900 | |
| Density | 1.512 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H15NO7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-amino-5-methoxy-2-methylphenyl)sulfonylethyl hydrogen sulfate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.512 g/cm3 |
|---|---|
| Molecular Formula | C10H15NO7S2 |
| Molecular Weight | 325.35900 |
| Exact Mass | 325.02900 |
| PSA | 149.75000 |
| LogP | 2.92170 |
| Index of Refraction | 1.579 |
| InChIKey | MRILAYPKVVWTRG-UHFFFAOYSA-N |
| SMILES | COc1cc(S(=O)(=O)CCOS(=O)(=O)O)c(C)cc1N |
| HS Code | 2930909090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 244-486-4 |
| 2-[(4-amino-5-methoxy-o-tolyl)sulfonyl]ethyl hydrogen sulfate |
| 2-methoxy-5-methyl-4-(-sulfatoethylsulfonyl)aniline |
| 2-((4-Amino-5-methoxy-o-tolyl)sulphonyl)ethyl hydrogen sulphate |
| 2-[(4-Amino-5-Methoxy-2-Methylphenyl)Sulfonyl]-Ethanol 1-(Hydrogen Sulfate) |
| 2-(4-Amino-2-methyl-5-methoxyphenylsulfonyl)aethylsulfat |
| 2-[(4-amino-5-methoxy-2-methylphenyl)sulfonyl]ethyl hydrogen sulfate |