(4-decoxy-2-hydroxyphenyl)-phenylmethanone
Modify Date: 2025-09-22 17:30:51
(4-decoxy-2-hydroxyphenyl)-phenylmethanone structure
|
Common Name | (4-decoxy-2-hydroxyphenyl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 2162-63-2 | Molecular Weight | 354.48300 | |
| Density | 1.047g/cm3 | Boiling Point | 482.4ºC at 760 mmHg | |
| Molecular Formula | C23H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.4ºC | |
| Name | (4-decoxy-2-hydroxyphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.047g/cm3 |
|---|---|
| Boiling Point | 482.4ºC at 760 mmHg |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.48300 |
| Flash Point | 159.4ºC |
| Exact Mass | 354.21900 |
| PSA | 46.53000 |
| LogP | 6.14270 |
| Vapour Pressure | 6.26E-10mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | JQSSXIRDGUMPNP-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)c2ccccc2)c(O)c1 |
| HS Code | 2914509090 |
|---|
|
~%
(4-decoxy-2-hyd... CAS#:2162-63-2 |
| Literature: Beger, J.; Binte, H.-J.; Brunne, L.; Neumann, R. Journal fuer Praktische Chemie/Chemiker-Zeitung, 1992 , vol. 334, # 3 p. 269 - 277 |
|
~%
(4-decoxy-2-hyd... CAS#:2162-63-2 |
| Literature: Beger, J.; Binte, H.-J.; Brunne, L.; Neumann, R. Journal fuer Praktische Chemie/Chemiker-Zeitung, 1992 , vol. 334, # 3 p. 269 - 277 |
|
~%
(4-decoxy-2-hyd... CAS#:2162-63-2 |
| Literature: Beger, J.; Binte, H.-J.; Brunne, L.; Neumann, R. Journal fuer Praktische Chemie/Chemiker-Zeitung, 1992 , vol. 334, # 3 p. 269 - 277 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 218-484-9 |
| 4-Decyloxy-2-hydroxybenzophenone |
| 2-Hydroxy-4-decyloxy-benzophenon |
| 2-Hydroxy-4-n-decyloxy-benzophenon |
| 2-Hydroxy-4-decyloxybenzophenone |