1,1,1,3,3,3-Hexafluoroisopropyl acrylate
Modify Date: 2025-08-21 19:11:08
1,1,1,3,3,3-Hexafluoroisopropyl acrylate structure
|
Common Name | 1,1,1,3,3,3-Hexafluoroisopropyl acrylate | ||
|---|---|---|---|---|
| CAS Number | 2160-89-6 | Molecular Weight | 222.08500 | |
| Density | 1.33 g/mL at 25 °C(lit.) | Boiling Point | 84 °C | |
| Molecular Formula | C6H4F6O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 50 °F | |
| Symbol |
GHS02, GHS07, GHS09 |
Signal Word | Danger | |
| Name | 1,1,1,3,3,3-hexafluoropropan-2-yl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 84 °C |
| Molecular Formula | C6H4F6O2 |
| Molecular Weight | 222.08500 |
| Flash Point | 50 °F |
| Exact Mass | 222.01200 |
| PSA | 26.30000 |
| LogP | 2.20880 |
| Vapour Pressure | 23.9mmHg at 25°C |
| Index of Refraction | n20/D 1.319(lit.) |
| InChIKey | MNSWITGNWZSAMC-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC(C(F)(F)F)C(F)(F)F |
| Storage condition | Flammables area |
| Symbol |
GHS02, GHS07, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H315-H319-H335-H411 |
| Precautionary Statements | P210-P261-P273-P305 + P351 + P338 |
| Hazard Codes | F:Flammable;Xi:Irritant; |
| Risk Phrases | R11;R36/37/38 |
| Safety Phrases | S26-S28-S61-S37/39-S16 |
| RIDADR | UN 3272 3/PG 2 |
| WGK Germany | 2 |
| Packaging Group | II |
| Hazard Class | 3 |
| HS Code | 2916129000 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:920-66-1
CAS#:79-10-7| HS Code | 2916129000 |
|---|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,1,1,3,3,3-hexafluoroprop-2-yl acrylate |
| 1,1,1,3,3,3-hexafluoropropan-2-yl acrylate |
| Acrylic Acid 1,1,1,3,3,3-Hexafluoroisopropyl Ester |
| hexafluoro-2-propyl acrylate |
| Hexafluoroisopropyl acrylate |
| EINECS 218-479-1 |
| 1,1,1,3,3,3-hexafluoroisopropylacrylate |
| MFCD00040104 |
| 1,1,1,3,3,3-Hexafluoroisopropyl Acrylate |