KRas G12C inhibitor 1
Modify Date: 2025-08-25 11:44:55
KRas G12C inhibitor 1 structure
|
Common Name | KRas G12C inhibitor 1 | ||
|---|---|---|---|---|
| CAS Number | 2158297-28-8 | Molecular Weight | 542.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H38N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of KRas G12C inhibitor 1KRas G12C inhibitor 1 is a compound that inhibits KRas G12C, extracted from patent US 20180072723 A1. |
| Name | KRas G12C inhibitor 1 |
|---|
| Description | KRas G12C inhibitor 1 is a compound that inhibits KRas G12C, extracted from patent US 20180072723 A1. |
|---|---|
| Related Catalog | |
| Target |
KRas G12C[1] |
| References |
[1]. Blake J, et al. Kras g12c inhibitors. US 20180072723 A1. |
| Molecular Formula | C31H38N6O3 |
|---|---|
| Molecular Weight | 542.67 |
| InChIKey | LTVKHYYCQYQXDM-GMAHTHKFSA-N |
| SMILES | C=CC(=O)N1CCN(c2nc(OCC3CCCN3C)nc3c2CCN(c2cc(O)cc4ccccc24)C3)C(C)C1 |