N,N'-bis[2-(4-chloro-phenyl)-ethyl]-3,4,9,10-perylene tetradicarboximide structure
|
Common Name | N,N'-bis[2-(4-chloro-phenyl)-ethyl]-3,4,9,10-perylene tetradicarboximide | ||
|---|---|---|---|---|
| CAS Number | 215726-51-5 | Molecular Weight | 667.536 | |
| Density | 1.5±0.0 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C40H24Cl2N2O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 2,9-Bis[2-(4-chlorophenyl)ethyl]isoquinolino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.0 g/cm3 |
|---|---|
| Molecular Formula | C40H24Cl2N2O4 |
| Molecular Weight | 667.536 |
| Exact Mass | 666.111328 |
| LogP | 7.45 |
| Index of Refraction | 1.806 |
| InChIKey | QSDATNMVYLQQKT-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C(=O)N1CCc1ccc(Cl)cc1)c64)C(=O)N(CCc1ccc(Cl)cc1)C5=O |
| RIDADR | NONH for all modes of transport |
|---|
| 2,9-Bis[2-(4-chlorophenyl)ethyl]isoquinolino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone |
| Isoquino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone, 2,9-bis[2-(4-chlorophenyl)ethyl]- |
| MFCD23704417 |