8-amino-9,10-dihydro-9,10-dioxoanthracenesulphonic acid
Modify Date: 2025-09-12 20:22:13
8-amino-9,10-dihydro-9,10-dioxoanthracenesulphonic acid structure
|
Common Name | 8-amino-9,10-dihydro-9,10-dioxoanthracenesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 21552-84-1 | Molecular Weight | 303.29000 | |
| Density | 1.647g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H9NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-amino-9,10-dioxoanthracene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.647g/cm3 |
|---|---|
| Molecular Formula | C14H9NO5S |
| Molecular Weight | 303.29000 |
| Exact Mass | 303.02000 |
| PSA | 122.91000 |
| LogP | 2.95290 |
| Index of Refraction | 1.721 |
| InChIKey | UEZJOQCWOFDUOR-UHFFFAOYSA-N |
| SMILES | Nc1cccc2c1C(=O)c1c(cccc1S(=O)(=O)O)C2=O |
| HS Code | 2922399090 |
|---|
|
~%
8-amino-9,10-di... CAS#:21552-84-1 |
| Literature: Bayer and Co. Patent: DE167169 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 8, p. 232 Full Text Show Details Schmidt,R. E. Chemische Berichte, 1904 , vol. 37, p. 72 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 8-amino-9,10-dioxo-9,10-dihydroanthracene-1-sulfonic acid |
| 1-Aminoanthrachinon-8-sulfonsaeure |
| EINECS 244-440-3 |
| 1-Aminoanthraquinone-8-sulfonicacid |
| 8-Aminoanthrachinon-1-sulfonsaeure |
| 8-Amino-9,10-dioxo-9,10-dihydro-anthracen-1-sulfonsaeure |
| 8-amino-9,10-dihydro-9,10-dioxoanthracenesulfonic acid |