2-acetoxybutyrophenone
Modify Date: 2025-09-22 20:20:41
2-acetoxybutyrophenone structure
|
Common Name | 2-acetoxybutyrophenone | ||
|---|---|---|---|---|
| CAS Number | 21550-10-7 | Molecular Weight | 206.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-oxo-1-phenylbutan-2-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14O3 |
|---|---|
| Molecular Weight | 206.23800 |
| Exact Mass | 206.09400 |
| PSA | 43.37000 |
| LogP | 2.59470 |
| InChIKey | NFLPTNUUNCIKKF-UHFFFAOYSA-N |
| SMILES | CCC(OC(C)=O)C(=O)c1ccccc1 |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| Butyrophenone,2'-hydroxy-,acetate (8CI) |
| 1-Butanone,2-(acetyloxy)-1-phenyl |
| 1-Butanone,1-[2-(acetyloxy)phenyl] |
| 2-ACETOXYBUTYROPHENONE |
| o-Acetoxy-butyrophenon |
| 2-Acetyloxyphenyl propyl ketone |