NBI-921352
Modify Date: 2025-09-18 15:29:30
NBI-921352 structure
|
Common Name | NBI-921352 | ||
|---|---|---|---|---|
| CAS Number | 2154408-63-4 | Molecular Weight | 460.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H25FN4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NBI-921352NBI-921352 (XEN901) is a potent inhibitor of sodium channels, specially targeting Nat/1.6 channels. NBI-921352 (XEN901) treats the nervous system pathologies of epilepsy effectively without adverse side effects (extracted from patent WO2017201468A1)[1]. |
| Name | NBI-921352 |
|---|
| Description | NBI-921352 (XEN901) is a potent inhibitor of sodium channels, specially targeting Nat/1.6 channels. NBI-921352 (XEN901) treats the nervous system pathologies of epilepsy effectively without adverse side effects (extracted from patent WO2017201468A1)[1]. |
|---|---|
| Related Catalog | |
| Target |
Nat/1.6 channels[1] |
| References |
| Molecular Formula | C22H25FN4O2S2 |
|---|---|
| Molecular Weight | 460.59 |
| InChIKey | UCSHINHOAVARGQ-GOSISDBHSA-N |
| SMILES | Cc1cc(S(=O)(=O)Nc2cscn2)c(F)cc1N(C)C1CCN(Cc2ccccc2)C1 |