2-(5-tert-butyl-1H-pyrazol-3-yl)pyridine
Modify Date: 2025-08-26 09:45:35
2-(5-tert-butyl-1H-pyrazol-3-yl)pyridine structure
|
Common Name | 2-(5-tert-butyl-1H-pyrazol-3-yl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 215323-54-9 | Molecular Weight | 201.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(5-tert-butyl-1H-pyrazol-3-yl)pyridine |
|---|
| Molecular Formula | C12H15N3 |
|---|---|
| Molecular Weight | 201.26800 |
| Exact Mass | 201.12700 |
| PSA | 41.57000 |
| LogP | 2.76920 |
| InChIKey | CMYVQGDPGNRRDR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(-c2ccccn2)n[nH]1 |
|
~%
2-(5-tert-butyl... CAS#:215323-54-9 |
| Literature: Satake, Akiharu; Nakata, Tadashi Journal of the American Chemical Society, 1998 , vol. 120, # 40 p. 10391 - 10396 |
|
~%
2-(5-tert-butyl... CAS#:215323-54-9 |
| Literature: Satake, Akiharu; Nakata, Tadashi Journal of the American Chemical Society, 1998 , vol. 120, # 40 p. 10391 - 10396 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |