AN15368 structure
|
Common Name | AN15368 | ||
|---|---|---|---|---|
| CAS Number | 2152662-92-3 | Molecular Weight | 389.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H28BNO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AN15368AN15368 is an orally active small-molecule precursor that can be activated by parasite carboxypeptidase to produce a compound that targets the messenger RNA processing pathway in T. cruzi. cruzi. AN15368 has the potential to prevent and research Chagas disease potential[1]. |
| Name | AN15368 |
|---|
| Description | AN15368 is an orally active small-molecule precursor that can be activated by parasite carboxypeptidase to produce a compound that targets the messenger RNA processing pathway in T. cruzi. cruzi. AN15368 has the potential to prevent and research Chagas disease potential[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H28BNO6 |
|---|---|
| Molecular Weight | 389.25 |
| InChIKey | MCKPYEQRZUCJKI-SFHVURJKSA-N |
| SMILES | Cc1c(C(=O)NC(C(=O)OCC2CCOCC2)C(C)C)ccc2c1B(O)OC2 |