2-tert-butyl-6-[(2-propan-2-ylanilino)methylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 2-tert-butyl-6-[(2-propan-2-ylanilino)methylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 215033-72-0 | Molecular Weight | 295.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-tert-butyl-6-[(2-propan-2-ylanilino)methylidene]cyclohexa-2,4-dien-1-one |
|---|
| Molecular Formula | C20H25NO |
|---|---|
| Molecular Weight | 295.41900 |
| Exact Mass | 295.19400 |
| PSA | 29.10000 |
| LogP | 5.29020 |
| InChIKey | FNVXCOAPSDAVKG-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccccc1N=Cc1cccc(C(C)(C)C)c1O |
|
~%
2-tert-butyl-6-... CAS#:215033-72-0 |
| Literature: Matsui; Mitani; Saito; Tohi; Makio; Matsukawa; Takagi; Tsuru; Nitabaru; Nakano; Tanaka; Kashiwa; Fujita Journal of the American Chemical Society, 2001 , vol. 123, # 28 p. 6847 - 6856 |
|
~%
2-tert-butyl-6-... CAS#:215033-72-0 |
| Literature: Matsui; Mitani; Saito; Tohi; Makio; Matsukawa; Takagi; Tsuru; Nitabaru; Nakano; Tanaka; Kashiwa; Fujita Journal of the American Chemical Society, 2001 , vol. 123, # 28 p. 6847 - 6856 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |