2'-Amino-5'-chloro-2,2,2-trifluoroacetophenone structure
|
Common Name | 2'-Amino-5'-chloro-2,2,2-trifluoroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 214353-17-0 | Molecular Weight | 278.05600 | |
| Density | 1.624g/cm3 | Boiling Point | 381.771ºC at 760 mmHg | |
| Molecular Formula | C8H8Cl2F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.689ºC | |
| Name | 2'-Amino-5'-chloro-2,2,2-trifluoroacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.624g/cm3 |
|---|---|
| Boiling Point | 381.771ºC at 760 mmHg |
| Molecular Formula | C8H8Cl2F3NO2 |
| Molecular Weight | 278.05600 |
| Flash Point | 184.689ºC |
| Exact Mass | 276.98800 |
| PSA | 66.48000 |
| LogP | 3.00510 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | SYLRXHNMJUPJDK-UHFFFAOYSA-N |
| SMILES | Cl.Nc1ccc(Cl)cc1C(O)(O)C(F)(F)F |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-5-chlorophenyl-2,2,2-trifluoroethanone |
| 2-[5-chloro-2-(hydroxyaMino)phenyl]-2,2-difluoroacetyl fluoride hydrochloride |
| 1,1-ETHANEDIOL,1-(2-AMINO-5-CHLOROPHENYL)-2,2,2-TRIFLUORO-,HYDROCHLORIDE |
| 2-TRIFLUOROACETYL-4-CHLORO ANILINE |
| 4-Chloro-2-trifluoroacetoaniline hydrochloride hydrate |
| 2'-AMino-5'-chloro-2,2,2-trifluoroacetophenone hydrochloride Monohydrate |
| 2-AMINO-5-CHLORO-2',2',2'-TRIFLUOROACETOPHENONE |
| Efavirinz intermediate |