4-bromo-1,2-dimethyl-5-nitroimidazole structure
|
Common Name | 4-bromo-1,2-dimethyl-5-nitroimidazole | ||
|---|---|---|---|---|
| CAS Number | 21431-58-3 | Molecular Weight | 220.02400 | |
| Density | 1.89g/cm3 | Boiling Point | 327ºC at 760mmHg | |
| Molecular Formula | C5H6BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.6ºC | |
| Name | 4-bromo-1,2-dimethyl-5-nitroimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.89g/cm3 |
|---|---|
| Boiling Point | 327ºC at 760mmHg |
| Molecular Formula | C5H6BrN3O2 |
| Molecular Weight | 220.02400 |
| Flash Point | 151.6ºC |
| Exact Mass | 218.96400 |
| PSA | 63.64000 |
| LogP | 1.92240 |
| Vapour Pressure | 0.000396mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | ZNTMHCHYIKJJMI-UHFFFAOYSA-N |
| SMILES | Cc1nc(Br)c([N+](=O)[O-])n1C |
| HS Code | 2933290090 |
|---|
|
~71%
4-bromo-1,2-dim... CAS#:21431-58-3 |
| Literature: Zaprutko, Lucjusz; Zwawiak, Justyna; Olender, Dorota; Gzella, Andrzej Heterocycles, 2012 , vol. 85, # 9 p. 2197 - 2211 |
|
~24%
4-bromo-1,2-dim... CAS#:21431-58-3 |
| Literature: Neilde, Kevin; Crozet, Maxime D.; Terme, Thierry; Vanelle, Patrice Synthesis (Germany), 2013 , vol. 45, # 10 art. no. SS-2013-Z0114-OP, p. 1349 - 1356 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-bromo-1,2-dimethyl-5-nitro-1H-imidazole |
| 4-Brom-1,2-dimethyl-5-nitro-1H-imidazol |
| 1,2-Dimethyl-4-brom-5-nitro-imidazol |
| Imidazole,4-bromo-1,2-dimethyl-5-nitro |