N,N-Dimethyl-4'-nitro-4-biphenylamine structure
|
Common Name | N,N-Dimethyl-4'-nitro-4-biphenylamine | ||
|---|---|---|---|---|
| CAS Number | 2143-87-5 | Molecular Weight | 242.273 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 398.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H14N2O2 | Melting Point | 246 °C | |
| MSDS | N/A | Flash Point | 194.6±23.2 °C | |
| Name | N,N-dimethyl-4-(4-nitrophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.2±25.0 °C at 760 mmHg |
| Melting Point | 246 °C |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.273 |
| Flash Point | 194.6±23.2 °C |
| Exact Mass | 242.105530 |
| PSA | 49.06000 |
| LogP | 3.70 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | PLGALHOPBAVGHQ-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2921499090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| [1,1'-Biphenyl]-4-amine, N,N-dimethyl-4'-nitro- |
| 4'-Nitro-4-dimethylamino-diphenyl |
| N,N-Dimethyl-4'-nitrobiphenyl-4-amine |
| N,N-Dimethyl-4'-nitro-4-biphenylamine |
| 4-DiMethylaMino-4'-nitrobiphenyl |