6-[(2-chlorophenyl)amino]-1H-pyrimidine-2,4-dione structure
|
Common Name | 6-[(2-chlorophenyl)amino]-1H-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 21416-58-0 | Molecular Weight | 237.64200 | |
| Density | 1.488g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(2-chloroanilino)-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.488g/cm3 |
|---|---|
| Molecular Formula | C10H8ClN3O2 |
| Molecular Weight | 237.64200 |
| Exact Mass | 237.03100 |
| PSA | 77.75000 |
| LogP | 1.53320 |
| Index of Refraction | 1.662 |
| InChIKey | XPZKTMYYBVDAFQ-UHFFFAOYSA-N |
| SMILES | O=c1cc(Nc2ccccc2Cl)[nH]c(=O)[nH]1 |
|
~60%
6-[(2-chlorophe... CAS#:21416-58-0 |
| Literature: Wilson, Jennifer M.; Henderson, Graham; Black, Fiona; Sutherland, Andrew; Ludwig, Robert L.; Vousden, Karen H.; Robins, David J. Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 1 p. 77 - 86 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-(2-Chlor-phenylamino)-uracil |
| 6-(2-chlorophenylamino)-1H-pyrimidine-2,4-dione |
| 6-[(2-chlorophenyl)amino]pyrimidine-2,4(1H,3H)-dione |
| 6-(2-chloro-anilino)-1H-pyrimidine-2,4-dione |