Chrysin dimethylether structure
|
Common Name | Chrysin dimethylether | ||
|---|---|---|---|---|
| CAS Number | 21392-57-4 | Molecular Weight | 282.291 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 476.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | 150-152ºC | |
| MSDS | N/A | Flash Point | 213.4±28.8 °C | |
Use of Chrysin dimethylether5,7-Dimethoxyflavone is one of the major components of Kaempferia parviflora, has anti-obesity, anti-inflammatory, and antineoplastic effects. 5,7-Dimethoxyflavone inhibits cytochrome P450 (CYP) 3As. 5,7-Dimethoxyflavone is also a potent Breast Cancer Resistance Protein (BCRP) inhibitor[1][2]. |
| Name | chrysin 5,7-dimethyl ether |
|---|---|
| Synonym | More Synonyms |
| Description | 5,7-Dimethoxyflavone is one of the major components of Kaempferia parviflora, has anti-obesity, anti-inflammatory, and antineoplastic effects. 5,7-Dimethoxyflavone inhibits cytochrome P450 (CYP) 3As. 5,7-Dimethoxyflavone is also a potent Breast Cancer Resistance Protein (BCRP) inhibitor[1][2]. |
|---|---|
| Related Catalog | |
| Target |
CYP3A Breast Cancer Resistance Protein (BCRP) |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 476.6±45.0 °C at 760 mmHg |
| Melting Point | 150-152ºC |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.291 |
| Flash Point | 213.4±28.8 °C |
| Exact Mass | 282.089203 |
| PSA | 48.67000 |
| LogP | 3.27 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | JRFZSUMZAUHNSL-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3ccccc3)oc2c1 |
| HS Code | 2914509090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5,7-dimethoxy-2-phenyl-4H-1-benzopyran-4-one |
| Dimethylchrysin |
| Chrysin DME |
| 5,7-dimethoxyflavonone |
| MFCD00016943 |
| 2-phenyl-5,7-dimethoxyl-flavone |
| 4H-1-Benzopyran-4-one,5,7-dimethoxy-2-phenyl |
| Chrysin 5,7-dimethyl ether |
| 4H-1-Benzopyran-4-one, 5,7-dimethoxy-2-phenyl- |
| 5,7-DIMETHOXYFLAVONE |
| 5,7-dimethoxy-2-phenylchromen-4-one |
| 5,7-dimethoxycrysin |
| 5,7-dimethoxy-2-phenyl-chromen-4-one |
| 5,7-Dimethoxy-2-phenyl-4H-chromen-4-one |
| Chrysindimethylether |
| Chrysin dimethylether |