1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride
Modify Date: 2026-07-03 20:38:54
![1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride Structure](https://www.chemsrc.com/extcaspic/147/2138564-65-3.png)
1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride structure
|
Common Name | 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2138564-65-3 | Molecular Weight | 252.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H17ClO3S |
|---|---|
| Molecular Weight | 252.76 |
| InChIKey | FUCIAAPAERNUKR-UHFFFAOYSA-N |
| SMILES | CC1(C)COC(CC2(S(=O)(=O)Cl)CC2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride? |
| A: The English name of 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride is 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride. |
| Q: What is the Chinese name of 2138564-65-3? |
| A: Chinese name of 2138564-65-3 is 2138564-65-3. |
| Q: What is the SMILES notation of 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride? |
| A: SMILES notation of 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride is CC1(C)COC(CC2(S(=O)(=O)Cl)CC2)C1. |
| Q: What is the InChIKey of 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride? |
| A: InChIKey of 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride is FUCIAAPAERNUKR-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride? |
| A: CAS number of 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride is 2138564-65-3. |
| Q: What is the molecular weight of 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride? |
| A: Molecular weight of 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride is 252.76. |
| Q: What is the molecular formula of 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride? |
| A: Molecular formula of 1-[(4,4-Dimethyloxolan-2-yl)methyl]cyclopropane-1-sulfonyl chloride is C10H17ClO3S. |