cholest-5-en-3β-ol, compound with (3β,5Z,7E)-9,10-secocholesta-5,7,10(19)-trien-3-ol structure
|
Common Name | cholest-5-en-3β-ol, compound with (3β,5Z,7E)-9,10-secocholesta-5,7,10(19)-trien-3-ol | ||
|---|---|---|---|---|
| CAS Number | 2138-18-3 | Molecular Weight | 771.29100 | |
| Density | N/A | Boiling Point | 480.6ºC at 760 mmHg | |
| Molecular Formula | C54H90O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.3ºC | |
| Name | (1R,3Z)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol,(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17 |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 480.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C54H90O2 |
| Molecular Weight | 771.29100 |
| Flash Point | 209.3ºC |
| Exact Mass | 770.69400 |
| PSA | 40.46000 |
| LogP | 15.00770 |
| Vapour Pressure | 2.95E-11mmHg at 25°C |
| InChIKey | BAPDQBCWGVYLDI-HHBZTYJMSA-N |
| SMILES | C=C1CCC(O)CC1=CC=C1CCCC2(C)C1CCC2C(C)CCCC(C)C.CC(C)CCCC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| Cholecalciferol,Verbindung mit Cholesterin |
| EINECS 218-379-8 |
| cholecalciferol,compound with cholesterol |
| Cholecalciferol mixture with cholesterol |