5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride
Modify Date: 2026-07-14 08:30:17
5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride structure
|
Common Name | 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2137817-06-0 | Molecular Weight | 245.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8FN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8FN3O3S |
|---|---|
| Molecular Weight | 245.23 |
| InChIKey | ACLPTUAIVWYVCD-UHFFFAOYSA-N |
| SMILES | Cc1nn(C)cc1-c1oncc1S(=O)(=O)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2137817-06-0? |
| A: Chinese name of 2137817-06-0 is 2137817-06-0. |
| Q: What is the CAS number of 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride? |
| A: CAS number of 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride is 2137817-06-0. |
| Q: What is the molecular weight of 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride? |
| A: Molecular weight of 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride is 245.23. |
| Q: What is the English name of 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride? |
| A: The English name of 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride is 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride. |
| Q: What is the InChIKey of 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride? |
| A: InChIKey of 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride is ACLPTUAIVWYVCD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride? |
| A: Molecular formula of 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride is C8H8FN3O3S. |
| Q: What is the SMILES notation of 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride? |
| A: SMILES notation of 5-(1,3-dimethyl-1H-pyrazol-4-yl)-1,2-oxazole-4-sulfonyl fluoride is Cc1nn(C)cc1-c1oncc1S(=O)(=O)F. |