N-Benzyl-4-(4-chlorophenyl)-1,3-thiazol-2-amine
Modify Date: 2025-10-10 13:58:03
N-Benzyl-4-(4-chlorophenyl)-1,3-thiazol-2-amine structure
|
Common Name | N-Benzyl-4-(4-chlorophenyl)-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 21344-81-0 | Molecular Weight | 300.80600 | |
| Density | 1.31g/cm3 | Boiling Point | 476.2ºC at 760 mmHg | |
| Molecular Formula | C16H13ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.8ºC | |
| Name | N-Benzyl-4-(4-chlorophenyl)-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 476.2ºC at 760 mmHg |
| Molecular Formula | C16H13ClN2S |
| Molecular Weight | 300.80600 |
| Flash Point | 241.8ºC |
| Exact Mass | 300.04900 |
| PSA | 56.39000 |
| LogP | 4.49750 |
| Vapour Pressure | 3.1E-09mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | QQDAIBUEPKCZLS-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2csc(NCc3ccccc3)n2)cc1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-benzylamino-4-(p-chlorophenyl)thiazole |
| benzyl-[4-(4-chlorophenyl)thiazol-2-yl]amine |